C30H44N2O11 — CID 155433709
[(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[8-(phenylmethoxycarbonylamino)octoxy]oxan-2-yl]methyl acetate (PubChem CID 155433709) has the molecular formula C30H44N2O11 and a molecular weight of 608.69 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[8-(phenylmethoxycarbonylamino)octoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[8-(phenylmethoxycarbonylamino)octoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155433709 |
| Molecular Formula | C30H44N2O11 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[8-(phenylmethoxycarbonylamino)octoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCCCCCCCNC(=O)OCc2ccccc2)[C@H](CC(N)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H44N2O11/c1-20(33)39-19-25-28(42-22(3)35)27(41-21(2)34)24(17-26(31)36)29(43-25)38-16-12-7-5-4-6-11-15-32-30(37)40-18-23-13-9-8-10-14-23/h8-10,13-14,24-25,27-29H,4-7,11-12,15-19H2,1-3H3,(H2,31,36)(H,32,37)/t24-,25-,27-,28+,29-/m1/s1 |
| InChIKey | BDONEMYFNRVHND-PMCIJNRMSA-N |
| XLogP | 2.91 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|