C27H38N2O11 — CID 155433750
[(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-2-yl]methyl acetate (PubChem CID 155433750) has the molecular formula C27H38N2O11 and a molecular weight of 566.60 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155433750 |
| Molecular Formula | C27H38N2O11 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCCCCNC(=O)OCc2ccccc2)[C@H](CC(N)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H38N2O11/c1-17(30)36-16-22-25(39-19(3)32)24(38-18(2)31)21(14-23(28)33)26(40-22)35-13-9-5-8-12-29-27(34)37-15-20-10-6-4-7-11-20/h4,6-7,10-11,21-22,24-26H,5,8-9,12-16H2,1-3H3,(H2,28,33)(H,29,34)/t21-,22-,24-,25+,26-/m1/s1 |
| InChIKey | VPUUCJHRNFLOTJ-ZGYMVXQNSA-N |
| XLogP | 1.74 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|