C19H18F4N2O3 — CID 155433784
(5S,8S)-5-fluoro-8-hydroxy-N-(3,3,3-trifluoro-1-phenoxypropyl)-7,8-dihydro-6H-quinoline-5-carboxamide (PubChem CID 155433784) has the molecular formula C19H18F4N2O3 and a molecular weight of 398.36 g/mol. Its IUPAC name is (5S,8S)-5-fluoro-8-hydroxy-N-(3,3,3-trifluoro-1-phenoxypropyl)-7,8-dihydro-6H-quinoline-5-carboxamide.
| Compound Name | (5S,8S)-5-fluoro-8-hydroxy-N-(3,3,3-trifluoro-1-phenoxypropyl)-7,8-dihydro-6H-quinoline-5-carboxamide |
|---|---|
| PubChem CID | 155433784 |
| Molecular Formula | C19H18F4N2O3 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (5S,8S)-5-fluoro-8-hydroxy-N-(3,3,3-trifluoro-1-phenoxypropyl)-7,8-dihydro-6H-quinoline-5-carboxamide |
| SMILES | O=C(NC(CC(F)(F)F)Oc1ccccc1)[C@]1(F)CC[C@H](O)c2ncccc21 |
| InChI | InChI=1S/C19H18F4N2O3/c20-18(9-8-14(26)16-13(18)7-4-10-24-16)17(27)25-15(11-19(21,22)23)28-12-5-2-1-3-6-12/h1-7,10,14-15,26H,8-9,11H2,(H,25,27)/t14-,15?,18-/m0/s1 |
| InChIKey | HAAJXPXFLCMLCR-RARQCXRASA-N |
| XLogP | 3.55 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|