C28H28F2N4O5 — CID 155434105
[(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl N-ethyl-N-methylcarbamate (PubChem CID 155434105) has the molecular formula C28H28F2N4O5 and a molecular weight of 538.55 g/mol. Its IUPAC name is [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl N-ethyl-N-methylcarbamate.
| Compound Name | [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl N-ethyl-N-methylcarbamate |
|---|---|
| PubChem CID | 155434105 |
| Molecular Formula | C28H28F2N4O5 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl N-ethyl-N-methylcarbamate |
| SMILES | CCN(C)C(=O)OCOc1c2n(ncc1=O)[C@@H](C(c1ccccc1)c1cccc(F)c1F)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C28H28F2N4O5/c1-3-32(2)28(37)39-16-38-26-21(35)15-31-34-24(20-13-8-14-33(20)27(36)25(26)34)22(17-9-5-4-6-10-17)18-11-7-12-19(29)23(18)30/h4-7,9-12,15,20,22,24H,3,8,13-14,16H2,1-2H3/t20-,22?,24-/m1/s1 |
| InChIKey | LKMCRHITTKFWAN-YQNXBIPGSA-N |
| XLogP | 3.94 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|