C21H18N2O2S2 — CID 155434714
(2Z)-2-cyano-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-2-thieno[2,3-b]thiochromen-4-ylideneacetamide (PubChem CID 155434714) has the molecular formula C21H18N2O2S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is (2Z)-2-cyano-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-2-thieno[2,3-b]thiochromen-4-ylideneacetamide.
| Compound Name | (2Z)-2-cyano-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-2-thieno[2,3-b]thiochromen-4-ylideneacetamide |
|---|---|
| PubChem CID | 155434714 |
| Molecular Formula | C21H18N2O2S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (2Z)-2-cyano-N-[2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-2-thieno[2,3-b]thiochromen-4-ylideneacetamide |
| SMILES | C=C(C)C(=C)OCCNC(=O)/C(C#N)=C1/c2ccccc2Sc2sccc21 |
| InChI | InChI=1S/C21H18N2O2S2/c1-13(2)14(3)25-10-9-23-20(24)17(12-22)19-15-6-4-5-7-18(15)27-21-16(19)8-11-26-21/h4-8,11H,1,3,9-10H2,2H3,(H,23,24)/b19-17- |
| InChIKey | NXMNNASASOFNHW-ZPHPHTNESA-N |
| XLogP | 4.76 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|