C36H35Cl4N3O5 — CID 155435025
[7-[[(2S)-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]amino]-7-oxoheptyl]carbamic acid (PubChem CID 155435025) has the molecular formula C36H35Cl4N3O5 and a molecular weight of 731.50 g/mol. Its IUPAC name is [7-[[(2S)-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]amino]-7-oxoheptyl]carbamic acid.
| Compound Name | [7-[[(2S)-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]amino]-7-oxoheptyl]carbamic acid |
|---|---|
| PubChem CID | 155435025 |
| Molecular Formula | C36H35Cl4N3O5 |
| Molecular Weight | 731.50 g/mol |
| Exact Mass | 729.13 |
| IUPAC Name | [7-[[(2S)-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]amino]-7-oxoheptyl]carbamic acid |
| SMILES | O=C(O)NCCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)N1C/C(=C\c2ccc(Cl)c(Cl)c2)C(=O)/C(=C/c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C36H35Cl4N3O5/c37-28-13-11-24(18-30(28)39)16-26-21-43(22-27(34(26)45)17-25-12-14-29(38)31(40)19-25)35(46)32(20-23-8-4-3-5-9-23)42-33(44)10-6-1-2-7-15-41-36(47)48/h3-5,8-9,11-14,16-19,32,41H,1-2,6-7,10,15,20-22H2,(H,42,44)(H,47,48)/b26-16+,27-17+/t32-/m0/s1 |
| InChIKey | FOEHKMNXFKODGO-DYGFWUGMSA-N |
| XLogP | 8.12 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.50 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|