About 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid
5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid (PubChem CID 155435323) has the molecular formula C7H2F2O2S2
and a molecular weight of 220.22 g/mol. Its IUPAC name is 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid |
| PubChem CID | 155435323 |
| Molecular Formula | C7H2F2O2S2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 219.95 |
| IUPAC Name | 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2sc(F)c(F)c2s1 |
| InChI | InChI=1S/C7H2F2O2S2/c8-4-5-2(13-6(4)9)1-3(12-5)7(10)11/h1H,(H,10,11) |
| InChIKey | YELALAJPIPNYDH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid?
The IUPAC name of 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid (CID 155435323) is 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid.
What is the SMILES notation for 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid?
The canonical SMILES for 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid is O=C(O)c1cc2sc(F)c(F)c2s1.
What is the InChIKey of 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid?
The InChIKey is YELALAJPIPNYDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2F2O2S2/c8-4-5-2(13-6(4)9)1-3(12-5)7(10)11/h1H,(H,10,11).
What are the key properties of 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid?
5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid has a molecular weight of 220.22 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid is sourced from PubChem (CID 155435323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).