5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid

C7H2F2O2S2 — CID 155435323

IUPAC5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid
SMILESO=C(O)c1cc2sc(F)c(F)c2s1
InChIInChI=1S/C7H2F2O2S2/c8-4-5-2(13-6(4)9)1-3(12-5)7(10)11/h1H,(H,10,11)
InChIKeyYELALAJPIPNYDH-UHFFFAOYSA-N
MW220.22 g/mol
LogP2.94
Rot. Bonds1

About 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid

5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid (PubChem CID 155435323) has the molecular formula C7H2F2O2S2 and a molecular weight of 220.22 g/mol. Its IUPAC name is 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid.

Molecular Properties

Compound Name5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid
PubChem CID155435323
Molecular FormulaC7H2F2O2S2
Molecular Weight220.22 g/mol
Exact Mass219.95
IUPAC Name5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid
SMILESO=C(O)c1cc2sc(F)c(F)c2s1
InChIInChI=1S/C7H2F2O2S2/c8-4-5-2(13-6(4)9)1-3(12-5)7(10)11/h1H,(H,10,11)
InChIKeyYELALAJPIPNYDH-UHFFFAOYSA-N
XLogP2.94
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.22
LogP ≤ 52.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid?
The IUPAC name of 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid (CID 155435323) is 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid.
What is the SMILES notation for 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid?
The canonical SMILES for 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid is O=C(O)c1cc2sc(F)c(F)c2s1.
What is the InChIKey of 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid?
The InChIKey is YELALAJPIPNYDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2F2O2S2/c8-4-5-2(13-6(4)9)1-3(12-5)7(10)11/h1H,(H,10,11).
What are the key properties of 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid?
5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid has a molecular weight of 220.22 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluorothieno[3,2-b]thiophene-2-carboxylic acid is sourced from PubChem (CID 155435323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).