C19H18N8O4 — CID 155435465
4-amino-2-(3-cyanophenyl)-6-[(3S)-oxolan-3-yl]oxy-N-(1H-1,2,4-triazol-5-ylmethoxy)pyrimidine-5-carboxamide (PubChem CID 155435465) has the molecular formula C19H18N8O4 and a molecular weight of 422.41 g/mol. Its IUPAC name is 4-amino-2-(3-cyanophenyl)-6-[(3S)-oxolan-3-yl]oxy-N-(1H-1,2,4-triazol-5-ylmethoxy)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-(3-cyanophenyl)-6-[(3S)-oxolan-3-yl]oxy-N-(1H-1,2,4-triazol-5-ylmethoxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155435465 |
| Molecular Formula | C19H18N8O4 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-amino-2-(3-cyanophenyl)-6-[(3S)-oxolan-3-yl]oxy-N-(1H-1,2,4-triazol-5-ylmethoxy)pyrimidine-5-carboxamide |
| SMILES | N#Cc1cccc(-c2nc(N)c(C(=O)NOCc3ncn[nH]3)c(O[C@H]3CCOC3)n2)c1 |
| InChI | InChI=1S/C19H18N8O4/c20-7-11-2-1-3-12(6-11)17-24-16(21)15(19(25-17)31-13-4-5-29-8-13)18(28)27-30-9-14-22-10-23-26-14/h1-3,6,10,13H,4-5,8-9H2,(H,27,28)(H2,21,24,25)(H,22,23,26)/t13-/m0/s1 |
| InChIKey | CKVYHYDYBJYPBM-ZDUSSCGKSA-N |
| XLogP | 0.74 |
| TPSA | 173.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|