C17H11Cl3N2OS — CID 155436502
1-(4-chlorophenyl)-3-[5-(3,5-dichlorophenyl)thiophen-2-yl]urea (PubChem CID 155436502) has the molecular formula C17H11Cl3N2OS and a molecular weight of 397.71 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[5-(3,5-dichlorophenyl)thiophen-2-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[5-(3,5-dichlorophenyl)thiophen-2-yl]urea |
|---|---|
| PubChem CID | 155436502 |
| Molecular Formula | C17H11Cl3N2OS |
| Molecular Weight | 397.71 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[5-(3,5-dichlorophenyl)thiophen-2-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(-c2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C17H11Cl3N2OS/c18-11-1-3-14(4-2-11)21-17(23)22-16-6-5-15(24-16)10-7-12(19)9-13(20)8-10/h1-9H,(H2,21,22,23) |
| InChIKey | XFOCMFZFOPJMOP-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.71 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |