C29H43N3O2 — CID 155436813
1-[2-[(1R,2S,7R,8S,11S,12S,16R,18R)-16-hydroxy-8,12,16-trimethyl-7-tetracyclo[9.9.0.02,8.012,18]icosanyl]-2-oxoethyl]pyrazole-4-carbonitrile (PubChem CID 155436813) has the molecular formula C29H43N3O2 and a molecular weight of 465.68 g/mol. Its IUPAC name is 1-[2-[(1R,2S,7R,8S,11S,12S,16R,18R)-16-hydroxy-8,12,16-trimethyl-7-tetracyclo[9.9.0.02,8.012,18]icosanyl]-2-oxoethyl]pyrazole-4-carbonitrile.
| Compound Name | 1-[2-[(1R,2S,7R,8S,11S,12S,16R,18R)-16-hydroxy-8,12,16-trimethyl-7-tetracyclo[9.9.0.02,8.012,18]icosanyl]-2-oxoethyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 155436813 |
| Molecular Formula | C29H43N3O2 |
| Molecular Weight | 465.68 g/mol |
| Exact Mass | 465.34 |
| IUPAC Name | 1-[2-[(1R,2S,7R,8S,11S,12S,16R,18R)-16-hydroxy-8,12,16-trimethyl-7-tetracyclo[9.9.0.02,8.012,18]icosanyl]-2-oxoethyl]pyrazole-4-carbonitrile |
| SMILES | C[C@@]1(O)CCC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@H](C(=O)Cn4cc(C#N)cn4)CCCC[C@@H]32)C1 |
| InChI | InChI=1S/C29H43N3O2/c1-27(34)12-6-13-28(2)21(15-27)9-10-22-23-7-4-5-8-25(29(23,3)14-11-24(22)28)26(33)19-32-18-20(16-30)17-31-32/h17-18,21-25,34H,4-15,19H2,1-3H3/t21-,22+,23+,24+,25+,27-,28+,29+/m1/s1 |
| InChIKey | NRSOKYMIJNGUPU-LOINIDTHSA-N |
| XLogP | 5.90 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |