pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid

C7H6N4O2 — CID 155437294

IUPACpyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid
SMILESO=C(O)Nc1ccc2cncnn12
InChIInChI=1S/C7H6N4O2/c12-7(13)10-6-2-1-5-3-8-4-9-11(5)6/h1-4,10H,(H,12,13)
InChIKeyHSFFGGPPTZOKPF-UHFFFAOYSA-N
MW178.15 g/mol
LogP0.82
Rot. Bonds1

About pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid

pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid (PubChem CID 155437294) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid.

Molecular Properties

Compound Namepyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid
PubChem CID155437294
Molecular FormulaC7H6N4O2
Molecular Weight178.15 g/mol
Exact Mass178.05
IUPAC Namepyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid
SMILESO=C(O)Nc1ccc2cncnn12
InChIInChI=1S/C7H6N4O2/c12-7(13)10-6-2-1-5-3-8-4-9-11(5)6/h1-4,10H,(H,12,13)
InChIKeyHSFFGGPPTZOKPF-UHFFFAOYSA-N
XLogP0.82
TPSA79.52 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.15
LogP ≤ 50.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid?
The IUPAC name of pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid (CID 155437294) is pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid.
What is the SMILES notation for pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid?
The canonical SMILES for pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid is O=C(O)Nc1ccc2cncnn12.
What is the InChIKey of pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid?
The InChIKey is HSFFGGPPTZOKPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O2/c12-7(13)10-6-2-1-5-3-8-4-9-11(5)6/h1-4,10H,(H,12,13).
What are the key properties of pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid?
pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid has a molecular weight of 178.15 g/mol, XLogP of 0.82, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,1-f][1,2,4]triazin-7-ylcarbamic acid is sourced from PubChem (CID 155437294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).