C19H23N5O3 — CID 155437521
3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-8-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,4-dione (PubChem CID 155437521) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-8-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,4-dione.
| Compound Name | 3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-8-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,4-dione |
|---|---|
| PubChem CID | 155437521 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-[4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-8-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,4-dione |
| SMILES | Cn1c(=O)n(C2C(=O)CCNC2=O)c2cccc(N3[C@@H]4CC[C@H]3CNC4)c21 |
| InChI | InChI=1S/C19H23N5O3/c1-22-16-13(23-11-5-6-12(23)10-20-9-11)3-2-4-14(16)24(19(22)27)17-15(25)7-8-21-18(17)26/h2-4,11-12,17,20H,5-10H2,1H3,(H,21,26)/t11-,12+,17? |
| InChIKey | SIJVJVQFABCOEA-GTKHYJCHSA-N |
| XLogP | -0.09 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|