C20H25N5O3 — CID 155438131
1-[2-[4-(hydroxymethyl)cyclohexyl]-6-methoxyindazol-5-yl]-2H-pyrazine-2-carboxamide (PubChem CID 155438131) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-[2-[4-(hydroxymethyl)cyclohexyl]-6-methoxyindazol-5-yl]-2H-pyrazine-2-carboxamide.
| Compound Name | 1-[2-[4-(hydroxymethyl)cyclohexyl]-6-methoxyindazol-5-yl]-2H-pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 155438131 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-[2-[4-(hydroxymethyl)cyclohexyl]-6-methoxyindazol-5-yl]-2H-pyrazine-2-carboxamide |
| SMILES | COc1cc2nn(C3CCC(CO)CC3)cc2cc1N1C=CN=CC1C(N)=O |
| InChI | InChI=1S/C20H25N5O3/c1-28-19-9-16-14(8-17(19)24-7-6-22-10-18(24)20(21)27)11-25(23-16)15-4-2-13(12-26)3-5-15/h6-11,13,15,18,26H,2-5,12H2,1H3,(H2,21,27) |
| InChIKey | HSFGCXJSYXWARU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |