About [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate
[(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate (PubChem CID 15543948) has the molecular formula C7H12O4S
and a molecular weight of 192.24 g/mol. Its IUPAC name is [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate |
| PubChem CID | 15543948 |
| Molecular Formula | C7H12O4S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H]1C=CC[C@H]1O |
| InChI | InChI=1S/C7H12O4S/c1-12(9,10)11-5-6-3-2-4-7(6)8/h2-3,6-8H,4-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | GYQUIODQUWRJII-RNFRBKRXSA-N |
| XLogP | -0.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate?
The IUPAC name of [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate (CID 15543948) is [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate.
What is the SMILES notation for [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate?
The canonical SMILES for [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate is CS(=O)(=O)OC[C@H]1C=CC[C@H]1O.
What is the InChIKey of [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate?
The InChIKey is GYQUIODQUWRJII-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H12O4S/c1-12(9,10)11-5-6-3-2-4-7(6)8/h2-3,6-8H,4-5H2,1H3/t6-,7-/m1/s1.
What are the key properties of [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate?
[(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate has a molecular weight of 192.24 g/mol, XLogP of -0.10, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5R)-5-hydroxycyclopent-2-en-1-yl]methyl methanesulfonate is sourced from PubChem (CID 15543948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).