C25H33NO4S — CID 155439709
2-methyl-2-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonylamino]phenyl]propanoic acid (PubChem CID 155439709) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is 2-methyl-2-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonylamino]phenyl]propanoic acid.
| Compound Name | 2-methyl-2-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 155439709 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 2-methyl-2-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)sulfonylamino]phenyl]propanoic acid |
| SMILES | Cc1cc2c(cc1S(=O)(=O)Nc1ccc(C(C)(C)C(=O)O)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H33NO4S/c1-16-14-19-20(24(4,5)13-12-23(19,2)3)15-21(16)31(29,30)26-18-10-8-17(9-11-18)25(6,7)22(27)28/h8-11,14-15,26H,12-13H2,1-7H3,(H,27,28) |
| InChIKey | UHZPCSOSOBBICN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |