C46H83NO — CID 155439853
4-[[(3R)-5,5-bis[(9Z,12Z)-octadeca-9,12-dienyl]oxolan-3-yl]methyl]piperidine (PubChem CID 155439853) has the molecular formula C46H83NO and a molecular weight of 666.18 g/mol. Its IUPAC name is 4-[[(3R)-5,5-bis[(9Z,12Z)-octadeca-9,12-dienyl]oxolan-3-yl]methyl]piperidine.
| Compound Name | 4-[[(3R)-5,5-bis[(9Z,12Z)-octadeca-9,12-dienyl]oxolan-3-yl]methyl]piperidine |
|---|---|
| PubChem CID | 155439853 |
| Molecular Formula | C46H83NO |
| Molecular Weight | 666.18 g/mol |
| Exact Mass | 665.65 |
| IUPAC Name | 4-[[(3R)-5,5-bis[(9Z,12Z)-octadeca-9,12-dienyl]oxolan-3-yl]methyl]piperidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)C[C@@H](CC2CCNCC2)CO1 |
| InChI | InChI=1S/C46H83NO/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-46(42-45(43-48-46)41-44-35-39-47-40-36-44)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,44-45,47H,3-10,15-16,21-43H2,1-2H3/b13-11-,14-12-,19-17-,20-18-/t45-/m1/s1 |
| InChIKey | YZFKSGGBAODFOU-JVEFJGDOSA-N |
| XLogP | 14.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.18 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|