C19H20ClFN2O6 — CID 155440006
2-[[(Z)-3-[5-[(4-chloro-2-fluorophenyl)methyl-formylamino]-3,6-dihydro-2H-pyran-4-yl]-3-hydroxy-2-methylprop-2-enoyl]amino]acetic acid (PubChem CID 155440006) has the molecular formula C19H20ClFN2O6 and a molecular weight of 426.83 g/mol. Its IUPAC name is 2-[[(Z)-3-[5-[(4-chloro-2-fluorophenyl)methyl-formylamino]-3,6-dihydro-2H-pyran-4-yl]-3-hydroxy-2-methylprop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[(Z)-3-[5-[(4-chloro-2-fluorophenyl)methyl-formylamino]-3,6-dihydro-2H-pyran-4-yl]-3-hydroxy-2-methylprop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 155440006 |
| Molecular Formula | C19H20ClFN2O6 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 2-[[(Z)-3-[5-[(4-chloro-2-fluorophenyl)methyl-formylamino]-3,6-dihydro-2H-pyran-4-yl]-3-hydroxy-2-methylprop-2-enoyl]amino]acetic acid |
| SMILES | C/C(C(=O)NCC(=O)O)=C(/O)C1=C(N(C=O)Cc2ccc(Cl)cc2F)COCC1 |
| InChI | InChI=1S/C19H20ClFN2O6/c1-11(19(28)22-7-17(25)26)18(27)14-4-5-29-9-16(14)23(10-24)8-12-2-3-13(20)6-15(12)21/h2-3,6,10,27H,4-5,7-9H2,1H3,(H,22,28)(H,25,26)/b18-11- |
| InChIKey | ZIHYXIPYKIZXSD-WQRHYEAKSA-N |
| XLogP | 2.14 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|