C21H31NO3 — CID 155440892
1-[(E)-3-(2-ethyl-4-pentoxyphenyl)but-2-enyl]azetidine-3-carboxylic acid (PubChem CID 155440892) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 1-[(E)-3-(2-ethyl-4-pentoxyphenyl)but-2-enyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[(E)-3-(2-ethyl-4-pentoxyphenyl)but-2-enyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155440892 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 1-[(E)-3-(2-ethyl-4-pentoxyphenyl)but-2-enyl]azetidine-3-carboxylic acid |
| SMILES | CCCCCOc1ccc(/C(C)=C/CN2CC(C(=O)O)C2)c(CC)c1 |
| InChI | InChI=1S/C21H31NO3/c1-4-6-7-12-25-19-8-9-20(17(5-2)13-19)16(3)10-11-22-14-18(15-22)21(23)24/h8-10,13,18H,4-7,11-12,14-15H2,1-3H3,(H,23,24)/b16-10+ |
| InChIKey | GLCDRESKYBLCRI-MHWRWJLKSA-N |
| XLogP | 4.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|