C20H21F9N2O2 — CID 155440959
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[3-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 155440959) has the molecular formula C20H21F9N2O2 and a molecular weight of 492.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[3-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[3-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 155440959 |
| Molecular Formula | C20H21F9N2O2 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[[3-(trifluoromethyl)phenyl]methyl]-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CCN(Cc3cccc(C(F)(F)F)c3)C2)CC1 |
| InChI | InChI=1S/C20H21F9N2O2/c21-18(22,23)14-3-1-2-13(10-14)11-30-7-4-17(12-30)5-8-31(9-6-17)16(32)33-15(19(24,25)26)20(27,28)29/h1-3,10,15H,4-9,11-12H2 |
| InChIKey | LSQGGAGLJIXSNA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |