About 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine
4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine (PubChem CID 155441163) has the molecular formula C11H15NS2
and a molecular weight of 225.38 g/mol. Its IUPAC name is 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine.
Molecular Properties
| Compound Name | 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine |
| PubChem CID | 155441163 |
| Molecular Formula | C11H15NS2 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine |
| SMILES | CCC1=CCSC(C2SC=CC2C)=N1 |
| InChI | InChI=1S/C11H15NS2/c1-3-9-5-7-14-11(12-9)10-8(2)4-6-13-10/h4-6,8,10H,3,7H2,1-2H3 |
| InChIKey | DOAXQKJWKRJVIS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine?
The IUPAC name of 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine (CID 155441163) is 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine.
What is the SMILES notation for 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine?
The canonical SMILES for 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine is CCC1=CCSC(C2SC=CC2C)=N1.
What is the InChIKey of 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine?
The InChIKey is DOAXQKJWKRJVIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS2/c1-3-9-5-7-14-11(12-9)10-8(2)4-6-13-10/h4-6,8,10H,3,7H2,1-2H3.
What are the key properties of 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine?
4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine has a molecular weight of 225.38 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-(3-methyl-2,3-dihydrothiophen-2-yl)-6H-1,3-thiazine is sourced from PubChem (CID 155441163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).