C10H14O2S2 — CID 15544201
(1S,2R)-3-(1,3-dithian-2-yl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 15544201) has the molecular formula C10H14O2S2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (1S,2R)-3-(1,3-dithian-2-yl)cyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2R)-3-(1,3-dithian-2-yl)cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 15544201 |
| Molecular Formula | C10H14O2S2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (1S,2R)-3-(1,3-dithian-2-yl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | O[C@@H]1C(C2SCCCS2)=CC=C[C@@H]1O |
| InChI | InChI=1S/C10H14O2S2/c11-8-4-1-3-7(9(8)12)10-13-5-2-6-14-10/h1,3-4,8-12H,2,5-6H2/t8-,9+/m0/s1 |
| InChIKey | PLPCKPVWLJYIFH-DTWKUNHWSA-N |
| XLogP | 1.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |