About 4-ethyltricyclo[5.2.1.02,6]decan-8-amine
4-ethyltricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 155442148) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 4-ethyltricyclo[5.2.1.02,6]decan-8-amine.
Molecular Properties
| Compound Name | 4-ethyltricyclo[5.2.1.02,6]decan-8-amine |
| PubChem CID | 155442148 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 4-ethyltricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | CCC1CC2C3CC(N)C(C3)C2C1 |
| InChI | InChI=1S/C12H21N/c1-2-7-3-9-8-5-11(10(9)4-7)12(13)6-8/h7-12H,2-6,13H2,1H3 |
| InChIKey | SWNMAGCXQJQPSR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyltricyclo[5.2.1.02,6]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyltricyclo[5.2.1.02,6]decan-8-amine?
The IUPAC name of 4-ethyltricyclo[5.2.1.02,6]decan-8-amine (CID 155442148) is 4-ethyltricyclo[5.2.1.02,6]decan-8-amine.
What is the SMILES notation for 4-ethyltricyclo[5.2.1.02,6]decan-8-amine?
The canonical SMILES for 4-ethyltricyclo[5.2.1.02,6]decan-8-amine is CCC1CC2C3CC(N)C(C3)C2C1.
What is the InChIKey of 4-ethyltricyclo[5.2.1.02,6]decan-8-amine?
The InChIKey is SWNMAGCXQJQPSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-2-7-3-9-8-5-11(10(9)4-7)12(13)6-8/h7-12H,2-6,13H2,1H3.
What are the key properties of 4-ethyltricyclo[5.2.1.02,6]decan-8-amine?
4-ethyltricyclo[5.2.1.02,6]decan-8-amine has a molecular weight of 179.31 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyltricyclo[5.2.1.02,6]decan-8-amine is sourced from PubChem (CID 155442148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).