About (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine
(4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine (PubChem CID 155442179) has the molecular formula C7H7BrF3N
and a molecular weight of 242.04 g/mol. Its IUPAC name is (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 155442179 |
| Molecular Formula | C7H7BrF3N |
| Molecular Weight | 242.04 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine |
| SMILES | NC1=CC[C@@H](C(F)(F)F)C=C1Br |
| InChI | InChI=1S/C7H7BrF3N/c8-5-3-4(7(9,10)11)1-2-6(5)12/h2-4H,1,12H2/t4-/m1/s1 |
| InChIKey | DTKHVSGOBKSEFC-SCSAIBSYSA-N |
| XLogP | 2.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.04 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine (CID 155442179) is (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine is NC1=CC[C@@H](C(F)(F)F)C=C1Br.
What is the InChIKey of (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The InChIKey is DTKHVSGOBKSEFC-SCSAIBSYSA-N. The full InChI is InChI=1S/C7H7BrF3N/c8-5-3-4(7(9,10)11)1-2-6(5)12/h2-4H,1,12H2/t4-/m1/s1.
What are the key properties of (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
(4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine has a molecular weight of 242.04 g/mol, XLogP of 2.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6-bromo-4-(trifluoromethyl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 155442179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).