About 2,4,4-trimethyl-N,N-dipropylpentan-2-amine
2,4,4-trimethyl-N,N-dipropylpentan-2-amine (PubChem CID 15544233) has the molecular formula C14H31N
and a molecular weight of 213.41 g/mol. Its IUPAC name is 2,4,4-trimethyl-N,N-dipropylpentan-2-amine.
Molecular Properties
| Compound Name | 2,4,4-trimethyl-N,N-dipropylpentan-2-amine |
| PubChem CID | 15544233 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | 2,4,4-trimethyl-N,N-dipropylpentan-2-amine |
| SMILES | CCCN(CCC)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H31N/c1-8-10-15(11-9-2)14(6,7)12-13(3,4)5/h8-12H2,1-7H3 |
| InChIKey | GITYXNPYNVCOLR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4,4-trimethyl-N,N-dipropylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,4-trimethyl-N,N-dipropylpentan-2-amine?
The IUPAC name of 2,4,4-trimethyl-N,N-dipropylpentan-2-amine (CID 15544233) is 2,4,4-trimethyl-N,N-dipropylpentan-2-amine.
What is the SMILES notation for 2,4,4-trimethyl-N,N-dipropylpentan-2-amine?
The canonical SMILES for 2,4,4-trimethyl-N,N-dipropylpentan-2-amine is CCCN(CCC)C(C)(C)CC(C)(C)C.
What is the InChIKey of 2,4,4-trimethyl-N,N-dipropylpentan-2-amine?
The InChIKey is GITYXNPYNVCOLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31N/c1-8-10-15(11-9-2)14(6,7)12-13(3,4)5/h8-12H2,1-7H3.
What are the key properties of 2,4,4-trimethyl-N,N-dipropylpentan-2-amine?
2,4,4-trimethyl-N,N-dipropylpentan-2-amine has a molecular weight of 213.41 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,4-trimethyl-N,N-dipropylpentan-2-amine is sourced from PubChem (CID 15544233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).