C17H23FN2 — CID 155442333
(5Z,7E,9E)-9-(1-fluoroethyl)-4-methyl-6-(methyliminomethyl)dodeca-3,5,7,9-tetraenenitrile (PubChem CID 155442333) has the molecular formula C17H23FN2 and a molecular weight of 274.38 g/mol. Its IUPAC name is (5Z,7E,9E)-9-(1-fluoroethyl)-4-methyl-6-(methyliminomethyl)dodeca-3,5,7,9-tetraenenitrile.
| Compound Name | (5Z,7E,9E)-9-(1-fluoroethyl)-4-methyl-6-(methyliminomethyl)dodeca-3,5,7,9-tetraenenitrile |
|---|---|
| PubChem CID | 155442333 |
| Molecular Formula | C17H23FN2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (5Z,7E,9E)-9-(1-fluoroethyl)-4-methyl-6-(methyliminomethyl)dodeca-3,5,7,9-tetraenenitrile |
| SMILES | CC/C=C(\C=C\C(=C\C(C)=CCC#N)\C=N\C)C(C)F |
| InChI | InChI=1S/C17H23FN2/c1-5-7-17(15(3)18)10-9-16(13-20-4)12-14(2)8-6-11-19/h7-10,12-13,15H,5-6H2,1-4H3/b10-9+,14-8?,16-12-,17-7+,20-13+ |
| InChIKey | NWGMPFDHBZMNHE-AYPCFJQJSA-N |
| XLogP | 4.72 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|