C16H29F2NO2 — CID 155442353
N-[2-[(3Z,5Z)-3,4-difluoro-5-methylhepta-3,5-dien-2-yl]oxyethyl]-2-ethoxy-N-ethylethanamine (PubChem CID 155442353) has the molecular formula C16H29F2NO2 and a molecular weight of 305.41 g/mol. Its IUPAC name is N-[2-[(3Z,5Z)-3,4-difluoro-5-methylhepta-3,5-dien-2-yl]oxyethyl]-2-ethoxy-N-ethylethanamine.
| Compound Name | N-[2-[(3Z,5Z)-3,4-difluoro-5-methylhepta-3,5-dien-2-yl]oxyethyl]-2-ethoxy-N-ethylethanamine |
|---|---|
| PubChem CID | 155442353 |
| Molecular Formula | C16H29F2NO2 |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | N-[2-[(3Z,5Z)-3,4-difluoro-5-methylhepta-3,5-dien-2-yl]oxyethyl]-2-ethoxy-N-ethylethanamine |
| SMILES | C/C=C(C)\C(F)=C(\F)C(C)OCCN(CC)CCOCC |
| InChI | InChI=1S/C16H29F2NO2/c1-6-13(4)15(17)16(18)14(5)21-12-10-19(7-2)9-11-20-8-3/h6,14H,7-12H2,1-5H3/b13-6-,16-15- |
| InChIKey | KYPGTTPHQDRKMQ-XTTIQGLUSA-N |
| XLogP | 3.87 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|