C58H45N3O — CID 155442658
2-(3-cyclohexa-1,3-dien-1-ylphenyl)-4-(3-phenylphenyl)-6-(2-spiro[3,4,5,10a-tetrahydroxanthene-9,9'-fluorene]-4-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine (PubChem CID 155442658) has the molecular formula C58H45N3O and a molecular weight of 800.02 g/mol. Its IUPAC name is 2-(3-cyclohexa-1,3-dien-1-ylphenyl)-4-(3-phenylphenyl)-6-(2-spiro[3,4,5,10a-tetrahydroxanthene-9,9'-fluorene]-4-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine.
| Compound Name | 2-(3-cyclohexa-1,3-dien-1-ylphenyl)-4-(3-phenylphenyl)-6-(2-spiro[3,4,5,10a-tetrahydroxanthene-9,9'-fluorene]-4-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 155442658 |
| Molecular Formula | C58H45N3O |
| Molecular Weight | 800.02 g/mol |
| Exact Mass | 799.36 |
| IUPAC Name | 2-(3-cyclohexa-1,3-dien-1-ylphenyl)-4-(3-phenylphenyl)-6-(2-spiro[3,4,5,10a-tetrahydroxanthene-9,9'-fluorene]-4-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine |
| SMILES | C1=CCCC(c2cccc(-c3nc(C4=C(C5CC=CC6=C5OC5CC=CC=C5C65c6ccccc6-c6ccccc65)C=CCC4)nc(-c4cccc(-c5ccccc5)c4)n3)c2)=C1 |
| InChI | InChI=1S/C58H45N3O/c1-3-18-38(19-4-1)40-22-15-24-42(36-40)55-59-56(43-25-16-23-41(37-43)39-20-5-2-6-21-39)61-57(60-55)48-29-8-7-26-44(48)47-30-17-34-52-54(47)62-53-35-14-13-33-51(53)58(52)49-31-11-9-27-45(49)46-28-10-12-32-50(46)58/h1-5,7,9-20,22-28,31-34,36-37,47,53H,6,8,21,29-30,35H2 |
| InChIKey | LUDNNQCNFGESKB-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.02 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |