C41H30N2O — CID 155442732
(Z)-1-phenyl-4-(4-spiro[4a,9a-dihydrofluorene-9,9'-xanthene]-2'-ylphenyl)but-2-ene-1,4-diimine (PubChem CID 155442732) has the molecular formula C41H30N2O and a molecular weight of 566.70 g/mol. Its IUPAC name is (Z)-1-phenyl-4-(4-spiro[4a,9a-dihydrofluorene-9,9'-xanthene]-2'-ylphenyl)but-2-ene-1,4-diimine.
| Compound Name | (Z)-1-phenyl-4-(4-spiro[4a,9a-dihydrofluorene-9,9'-xanthene]-2'-ylphenyl)but-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 155442732 |
| Molecular Formula | C41H30N2O |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | (Z)-1-phenyl-4-(4-spiro[4a,9a-dihydrofluorene-9,9'-xanthene]-2'-ylphenyl)but-2-ene-1,4-diimine |
| SMILES | [H]/N=C(/C=C\C(=N\[H])c1ccc(-c2ccc3c(c2)C2(c4ccccc4O3)c3ccccc3C3C=CC=CC32)cc1)c1ccccc1 |
| InChI | InChI=1S/C41H30N2O/c42-37(28-10-2-1-3-11-28)23-24-38(43)29-20-18-27(19-21-29)30-22-25-40-36(26-30)41(35-16-8-9-17-39(35)44-40)33-14-6-4-12-31(33)32-13-5-7-15-34(32)41/h1-26,31,33,42-43H/b24-23-,42-37-,43-38- |
| InChIKey | NTQZBFOYAPOZOH-FKXPICIISA-N |
| XLogP | 9.63 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|