About methyl 9-octylsulfanylnonanoate
methyl 9-octylsulfanylnonanoate (PubChem CID 15544279) has the molecular formula C18H36O2S
and a molecular weight of 316.55 g/mol. Its IUPAC name is methyl 9-octylsulfanylnonanoate.
Molecular Properties
| Compound Name | methyl 9-octylsulfanylnonanoate |
| PubChem CID | 15544279 |
| Molecular Formula | C18H36O2S |
| Molecular Weight | 316.55 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | methyl 9-octylsulfanylnonanoate |
| SMILES | CCCCCCCCSCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C18H36O2S/c1-3-4-5-6-10-13-16-21-17-14-11-8-7-9-12-15-18(19)20-2/h3-17H2,1-2H3 |
| InChIKey | FJCLBWBSAVTLHQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-octylsulfanylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-octylsulfanylnonanoate?
The IUPAC name of methyl 9-octylsulfanylnonanoate (CID 15544279) is methyl 9-octylsulfanylnonanoate.
What is the SMILES notation for methyl 9-octylsulfanylnonanoate?
The canonical SMILES for methyl 9-octylsulfanylnonanoate is CCCCCCCCSCCCCCCCCC(=O)OC.
What is the InChIKey of methyl 9-octylsulfanylnonanoate?
The InChIKey is FJCLBWBSAVTLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2S/c1-3-4-5-6-10-13-16-21-17-14-11-8-7-9-12-15-18(19)20-2/h3-17H2,1-2H3.
What are the key properties of methyl 9-octylsulfanylnonanoate?
methyl 9-octylsulfanylnonanoate has a molecular weight of 316.55 g/mol, XLogP of 5.98, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-octylsulfanylnonanoate is sourced from PubChem (CID 15544279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).