C52H37N3O — CID 155442837
2,4-diphenyl-6-[4-(2-spiro[1,2-dihydrofluorene-9,9'-3,4-dihydroxanthene]-4'-ylphenyl)phenyl]-1,3,5-triazine (PubChem CID 155442837) has the molecular formula C52H37N3O and a molecular weight of 719.89 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-(2-spiro[1,2-dihydrofluorene-9,9'-3,4-dihydroxanthene]-4'-ylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-(2-spiro[1,2-dihydrofluorene-9,9'-3,4-dihydroxanthene]-4'-ylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 155442837 |
| Molecular Formula | C52H37N3O |
| Molecular Weight | 719.89 g/mol |
| Exact Mass | 719.29 |
| IUPAC Name | 2,4-diphenyl-6-[4-(2-spiro[1,2-dihydrofluorene-9,9'-3,4-dihydroxanthene]-4'-ylphenyl)phenyl]-1,3,5-triazine |
| SMILES | C1=CC2=C(CC1)C1(C3=C(Oc4ccccc41)C(c1ccccc1-c1ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc1)CC=C3)c1ccccc12 |
| InChI | InChI=1S/C52H37N3O/c1-3-16-35(17-4-1)49-53-50(36-18-5-2-6-19-36)55-51(54-49)37-32-30-34(31-33-37)38-20-7-8-21-39(38)42-24-15-28-46-48(42)56-47-29-14-13-27-45(47)52(46)43-25-11-9-22-40(43)41-23-10-12-26-44(41)52/h1-11,13-23,25,27-33,42H,12,24,26H2 |
| InChIKey | XHOOCPFWMDYZEL-UHFFFAOYSA-N |
| XLogP | 12.33 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.89 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |