C53H41N3O — CID 155443411
2-cyclohexa-1,5-dien-1-yl-4-(6H-phenalen-2-yl)-6-(2-spiro[3,4,5,10a-tetrahydroxanthene-9,9'-fluorene]-4-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine (PubChem CID 155443411) has the molecular formula C53H41N3O and a molecular weight of 735.93 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-4-(6H-phenalen-2-yl)-6-(2-spiro[3,4,5,10a-tetrahydroxanthene-9,9'-fluorene]-4-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-4-(6H-phenalen-2-yl)-6-(2-spiro[3,4,5,10a-tetrahydroxanthene-9,9'-fluorene]-4-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 155443411 |
| Molecular Formula | C53H41N3O |
| Molecular Weight | 735.93 g/mol |
| Exact Mass | 735.32 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-4-(6H-phenalen-2-yl)-6-(2-spiro[3,4,5,10a-tetrahydroxanthene-9,9'-fluorene]-4-ylcyclohexa-1,3-dien-1-yl)-1,3,5-triazine |
| SMILES | C1=CCC2OC3=C(C=CCC3C3=C(c4nc(C5=CCCC=C5)nc(-c5cc6c7c(cccc7c5)CC=C6)n4)CCC=C3)C3(C2=C1)c1ccccc1-c1ccccc13 |
| InChI | InChI=1S/C53H41N3O/c1-2-15-34(16-3-1)50-54-51(37-31-35-19-12-17-33-18-13-20-36(32-37)48(33)35)56-52(55-50)42-24-5-4-21-38(42)41-25-14-29-46-49(41)57-47-30-11-10-28-45(47)53(46)43-26-8-6-22-39(43)40-23-7-9-27-44(40)53/h2,4,6-17,19-23,26-29,31-32,41,47H,1,3,5,18,24-25,30H2 |
| InChIKey | ZSFKOJDVSUWPBR-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.93 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |