About 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide
6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide (PubChem CID 155443579) has the molecular formula C12H20N2O
and a molecular weight of 208.31 g/mol. Its IUPAC name is 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide.
Molecular Properties
| Compound Name | 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide |
| PubChem CID | 155443579 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide |
| SMILES | C=C/C=C\C(=C)NCCCCCC(N)=O |
| InChI | InChI=1S/C12H20N2O/c1-3-4-8-11(2)14-10-7-5-6-9-12(13)15/h3-4,8,14H,1-2,5-7,9-10H2,(H2,13,15)/b8-4- |
| InChIKey | OJNFTCLKPZIZAE-YWEYNIOJSA-N |
| XLogP | 1.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide?
The IUPAC name of 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide (CID 155443579) is 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide.
What is the SMILES notation for 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide?
The canonical SMILES for 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide is C=C/C=C\C(=C)NCCCCCC(N)=O.
What is the InChIKey of 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide?
The InChIKey is OJNFTCLKPZIZAE-YWEYNIOJSA-N. The full InChI is InChI=1S/C12H20N2O/c1-3-4-8-11(2)14-10-7-5-6-9-12(13)15/h3-4,8,14H,1-2,5-7,9-10H2,(H2,13,15)/b8-4-.
What are the key properties of 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide?
6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide has a molecular weight of 208.31 g/mol, XLogP of 1.88, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(3Z)-hexa-1,3,5-trien-2-yl]amino]hexanamide is sourced from PubChem (CID 155443579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).