C10H17FO8P2 — CID 155444264
[[(2Z,3R,4R)-4-fluoro-3,6-dihydroxy-2-propylidenehex-5-ynoxy]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444264) has the molecular formula C10H17FO8P2 and a molecular weight of 346.18 g/mol. Its IUPAC name is [[(2Z,3R,4R)-4-fluoro-3,6-dihydroxy-2-propylidenehex-5-ynoxy]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2Z,3R,4R)-4-fluoro-3,6-dihydroxy-2-propylidenehex-5-ynoxy]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444264 |
| Molecular Formula | C10H17FO8P2 |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | [[(2Z,3R,4R)-4-fluoro-3,6-dihydroxy-2-propylidenehex-5-ynoxy]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC/C=C(/COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H](F)C#CO |
| InChI | InChI=1S/C10H17FO8P2/c1-2-3-8(10(13)9(11)4-5-12)6-19-21(17,18)7-20(14,15)16/h3,9-10,12-13H,2,6-7H2,1H3,(H,17,18)(H2,14,15,16)/b8-3-/t9-,10-/m1/s1 |
| InChIKey | XLQUCQRKNATUFA-HJBJALMNSA-N |
| XLogP | 0.69 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|