C23H30ClFN4O8P2 — CID 155444375
[[(Z)-2-[(1R,2S,3R)-3-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444375) has the molecular formula C23H30ClFN4O8P2 and a molecular weight of 606.91 g/mol. Its IUPAC name is [[(Z)-2-[(1R,2S,3R)-3-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(Z)-2-[(1R,2S,3R)-3-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444375 |
| Molecular Formula | C23H30ClFN4O8P2 |
| Molecular Weight | 606.91 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | [[(Z)-2-[(1R,2S,3R)-3-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-2-fluoro-1,3-dihydroxypropyl]pent-2-enoxy]-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC/C=C(/COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H](F)[C@@H](O)n1ncc2c(N[C@@H](C)c3ccccc3)cc(Cl)nc21 |
| InChI | InChI=1S/C23H30ClFN4O8P2/c1-3-7-16(12-37-39(35,36)13-38(32,33)34)21(30)20(25)23(31)29-22-17(11-26-29)18(10-19(24)28-22)27-14(2)15-8-5-4-6-9-15/h4-11,14,20-21,23,30-31H,3,12-13H2,1-2H3,(H,27,28)(H,35,36)(H2,32,33,34)/b16-7-/t14-,20-,21+,23+/m0/s1 |
| InChIKey | QBQOXCLYIVAAOW-MHZKONRGSA-N |
| XLogP | 4.12 |
| TPSA | 187.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.91 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|