C20H25ClN4O10P2 — CID 155444410
[[(2R,4S,5R)-5-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155444410) has the molecular formula C20H25ClN4O10P2 and a molecular weight of 578.84 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,4S,5R)-5-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155444410 |
| Molecular Formula | C20H25ClN4O10P2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | [[(2R,4S,5R)-5-[6-chloro-4-[[(1S)-1-phenylethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,3,4-trihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@H](Nc1cc(Cl)nc2c1cnn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)C(O)(O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H25ClN4O10P2/c1-11(12-5-3-2-4-6-12)23-14-7-16(21)24-18-13(14)8-22-25(18)19-17(26)20(27,28)15(35-19)9-34-37(32,33)10-36(29,30)31/h2-8,11,15,17,19,26-28H,9-10H2,1H3,(H,23,24)(H,32,33)(H2,29,30,31)/t11-,15+,17-,19+/m0/s1 |
| InChIKey | DJRPLHJXGMTCQR-TYVGYZLZSA-N |
| XLogP | 1.53 |
| TPSA | 216.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|