C18H36N2O4 — CID 155444678
2-(3-amino-3-methylbutoxy)-N-[3-(2,2-dimethyl-3-oxobutoxy)-2,2-dimethylpropyl]acetamide (PubChem CID 155444678) has the molecular formula C18H36N2O4 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-(3-amino-3-methylbutoxy)-N-[3-(2,2-dimethyl-3-oxobutoxy)-2,2-dimethylpropyl]acetamide.
| Compound Name | 2-(3-amino-3-methylbutoxy)-N-[3-(2,2-dimethyl-3-oxobutoxy)-2,2-dimethylpropyl]acetamide |
|---|---|
| PubChem CID | 155444678 |
| Molecular Formula | C18H36N2O4 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 2-(3-amino-3-methylbutoxy)-N-[3-(2,2-dimethyl-3-oxobutoxy)-2,2-dimethylpropyl]acetamide |
| SMILES | CC(=O)C(C)(C)COCC(C)(C)CNC(=O)COCCC(C)(C)N |
| InChI | InChI=1S/C18H36N2O4/c1-14(21)17(4,5)13-24-12-16(2,3)11-20-15(22)10-23-9-8-18(6,7)19/h8-13,19H2,1-7H3,(H,20,22) |
| InChIKey | IGKVQRJKHWBJED-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|