C23H24N6O2 — CID 155444794
5,26-dimethyl-7-oxa-4,5,13,20,22,27-hexazapentacyclo[22.3.1.02,6.013,21.014,19]octacosa-1(27),2(6),3,14,16,18,20,24(28),25-nonaen-23-one (PubChem CID 155444794) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 5,26-dimethyl-7-oxa-4,5,13,20,22,27-hexazapentacyclo[22.3.1.02,6.013,21.014,19]octacosa-1(27),2(6),3,14,16,18,20,24(28),25-nonaen-23-one.
| Compound Name | 5,26-dimethyl-7-oxa-4,5,13,20,22,27-hexazapentacyclo[22.3.1.02,6.013,21.014,19]octacosa-1(27),2(6),3,14,16,18,20,24(28),25-nonaen-23-one |
|---|---|
| PubChem CID | 155444794 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 5,26-dimethyl-7-oxa-4,5,13,20,22,27-hexazapentacyclo[22.3.1.02,6.013,21.014,19]octacosa-1(27),2(6),3,14,16,18,20,24(28),25-nonaen-23-one |
| SMILES | Cc1cc2cc(n1)-c1cnn(C)c1OCCCCCn1c(nc3ccccc31)NC2=O |
| InChI | InChI=1S/C23H24N6O2/c1-15-12-16-13-19(25-15)17-14-24-28(2)22(17)31-11-7-3-6-10-29-20-9-5-4-8-18(20)26-23(29)27-21(16)30/h4-5,8-9,12-14H,3,6-7,10-11H2,1-2H3,(H,26,27,30) |
| InChIKey | HSZPBWABHVELOA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |