About N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine
N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine (PubChem CID 15544551) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine.
Molecular Properties
| Compound Name | N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine |
| PubChem CID | 15544551 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine |
| SMILES | C1=CC(/N=C/C=N/C2C=CC=C2)C=C1 |
| InChI | InChI=1S/C12H12N2/c1-2-6-11(5-1)13-9-10-14-12-7-3-4-8-12/h1-12H/b13-9+,14-10+ |
| InChIKey | WNKMRXUTNKDPEA-UTLPMFLDSA-N |
| XLogP | 2.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine?
The IUPAC name of N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine (CID 15544551) is N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine.
What is the SMILES notation for N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine?
The canonical SMILES for N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine is C1=CC(/N=C/C=N/C2C=CC=C2)C=C1.
What is the InChIKey of N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine?
The InChIKey is WNKMRXUTNKDPEA-UTLPMFLDSA-N. The full InChI is InChI=1S/C12H12N2/c1-2-6-11(5-1)13-9-10-14-12-7-3-4-8-12/h1-12H/b13-9+,14-10+.
What are the key properties of N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine?
N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine has a molecular weight of 184.24 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-di(cyclopenta-2,4-dien-1-yl)ethane-1,2-diimine is sourced from PubChem (CID 15544551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).