C26H41N3O — CID 155445577
N-[[(1S,4bR,8S,10aS,12aS)-8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]methyl]-2-methylpyrazole-3-carboxamide (PubChem CID 155445577) has the molecular formula C26H41N3O and a molecular weight of 411.63 g/mol. Its IUPAC name is N-[[(1S,4bR,8S,10aS,12aS)-8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]methyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[[(1S,4bR,8S,10aS,12aS)-8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]methyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 155445577 |
| Molecular Formula | C26H41N3O |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.32 |
| IUPAC Name | N-[[(1S,4bR,8S,10aS,12aS)-8,12a-dimethyl-2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,10b,11,12-hexadecahydro-1H-chrysen-1-yl]methyl]-2-methylpyrazole-3-carboxamide |
| SMILES | C[C@H]1CC[C@H]2C(CC[C@@H]3C2CC[C@@]2(C)C3CCC[C@@H]2CNC(=O)c2ccnn2C)C1 |
| InChI | InChI=1S/C26H41N3O/c1-17-7-9-20-18(15-17)8-10-22-21(20)11-13-26(2)19(5-4-6-23(22)26)16-27-25(30)24-12-14-28-29(24)3/h12,14,17-23H,4-11,13,15-16H2,1-3H3,(H,27,30)/t17-,18?,19+,20-,21?,22+,23?,26+/m0/s1 |
| InChIKey | AHJAKEQFXWAWGZ-CYTXEGKESA-N |
| XLogP | 5.44 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |