About 5-(4-tert-butylphenyl)-1,2-dimethylimidazole
5-(4-tert-butylphenyl)-1,2-dimethylimidazole (PubChem CID 155445809) has the molecular formula C15H20N2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-1,2-dimethylimidazole.
Molecular Properties
| Compound Name | 5-(4-tert-butylphenyl)-1,2-dimethylimidazole |
| PubChem CID | 155445809 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 5-(4-tert-butylphenyl)-1,2-dimethylimidazole |
| SMILES | Cc1ncc(-c2ccc(C(C)(C)C)cc2)n1C |
| InChI | InChI=1S/C15H20N2/c1-11-16-10-14(17(11)5)12-6-8-13(9-7-12)15(2,3)4/h6-10H,1-5H3 |
| InChIKey | GRDUKERLRXQOGA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-tert-butylphenyl)-1,2-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-tert-butylphenyl)-1,2-dimethylimidazole?
The IUPAC name of 5-(4-tert-butylphenyl)-1,2-dimethylimidazole (CID 155445809) is 5-(4-tert-butylphenyl)-1,2-dimethylimidazole.
What is the SMILES notation for 5-(4-tert-butylphenyl)-1,2-dimethylimidazole?
The canonical SMILES for 5-(4-tert-butylphenyl)-1,2-dimethylimidazole is Cc1ncc(-c2ccc(C(C)(C)C)cc2)n1C.
What is the InChIKey of 5-(4-tert-butylphenyl)-1,2-dimethylimidazole?
The InChIKey is GRDUKERLRXQOGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2/c1-11-16-10-14(17(11)5)12-6-8-13(9-7-12)15(2,3)4/h6-10H,1-5H3.
What are the key properties of 5-(4-tert-butylphenyl)-1,2-dimethylimidazole?
5-(4-tert-butylphenyl)-1,2-dimethylimidazole has a molecular weight of 228.34 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-tert-butylphenyl)-1,2-dimethylimidazole is sourced from PubChem (CID 155445809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).