C25H22F3N5O3 — CID 155445822
N-methyl-4-[8-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]benzamide (PubChem CID 155445822) has the molecular formula C25H22F3N5O3 and a molecular weight of 497.48 g/mol. Its IUPAC name is N-methyl-4-[8-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]benzamide.
| Compound Name | N-methyl-4-[8-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]benzamide |
|---|---|
| PubChem CID | 155445822 |
| Molecular Formula | C25H22F3N5O3 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-methyl-4-[8-oxo-5-[[4-(trifluoromethoxy)phenyl]methyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]benzamide |
| SMILES | CNC(=O)c1ccc(-n2c(=O)c3c(n4ncc(Cc5ccc(OC(F)(F)F)cc5)c24)CNCC3)cc1 |
| InChI | InChI=1S/C25H22F3N5O3/c1-29-22(34)16-4-6-18(7-5-16)32-23-17(12-15-2-8-19(9-3-15)36-25(26,27)28)13-31-33(23)21-14-30-11-10-20(21)24(32)35/h2-9,13,30H,10-12,14H2,1H3,(H,29,34) |
| InChIKey | JZGNNCQJGAPLOH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |