C33H26BrFN6O4 — CID 155445849
4-[12-(4-bromo-3-cyanobenzoyl)-5-[(2-fluoro-4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide (PubChem CID 155445849) has the molecular formula C33H26BrFN6O4 and a molecular weight of 669.51 g/mol. Its IUPAC name is 4-[12-(4-bromo-3-cyanobenzoyl)-5-[(2-fluoro-4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide.
| Compound Name | 4-[12-(4-bromo-3-cyanobenzoyl)-5-[(2-fluoro-4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 155445849 |
| Molecular Formula | C33H26BrFN6O4 |
| Molecular Weight | 669.51 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | 4-[12-(4-bromo-3-cyanobenzoyl)-5-[(2-fluoro-4-methoxyphenyl)methyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-n2c(=O)c3c(n4ncc(Cc5ccc(OC)cc5F)c24)CN(C(=O)c2ccc(Br)c(C#N)c2)CC3)cc1 |
| InChI | InChI=1S/C33H26BrFN6O4/c1-37-30(42)19-3-7-24(8-4-19)40-31-23(13-20-5-9-25(45-2)15-28(20)35)17-38-41(31)29-18-39(12-11-26(29)33(40)44)32(43)21-6-10-27(34)22(14-21)16-36/h3-10,14-15,17H,11-13,18H2,1-2H3,(H,37,42) |
| InChIKey | NVZKSTPJKNXAGC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |