C32H26Cl2F2N6O4 — CID 155446009
4-[12-(3,4-dichlorobenzoyl)-5-[[4-(difluoromethoxy)phenyl]methylamino]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide (PubChem CID 155446009) has the molecular formula C32H26Cl2F2N6O4 and a molecular weight of 667.50 g/mol. Its IUPAC name is 4-[12-(3,4-dichlorobenzoyl)-5-[[4-(difluoromethoxy)phenyl]methylamino]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide.
| Compound Name | 4-[12-(3,4-dichlorobenzoyl)-5-[[4-(difluoromethoxy)phenyl]methylamino]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 155446009 |
| Molecular Formula | C32H26Cl2F2N6O4 |
| Molecular Weight | 667.50 g/mol |
| Exact Mass | 666.14 |
| IUPAC Name | 4-[12-(3,4-dichlorobenzoyl)-5-[[4-(difluoromethoxy)phenyl]methylamino]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-n2c(=O)c3c(n4ncc(NCc5ccc(OC(F)F)cc5)c24)CN(C(=O)c2ccc(Cl)c(Cl)c2)CC3)cc1 |
| InChI | InChI=1S/C32H26Cl2F2N6O4/c1-37-28(43)19-4-7-21(8-5-19)41-29-26(38-15-18-2-9-22(10-3-18)46-32(35)36)16-39-42(29)27-17-40(13-12-23(27)31(41)45)30(44)20-6-11-24(33)25(34)14-20/h2-11,14,16,32,38H,12-13,15,17H2,1H3,(H,37,43) |
| InChIKey | UBMQXWLOPSUUEB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |