C12H22S — CID 155446054
(1R,2R,5S)-5-ethyl-2,6,6-trimethylbicyclo[3.1.1]heptane-1-thiol (PubChem CID 155446054) has the molecular formula C12H22S and a molecular weight of 198.37 g/mol. Its IUPAC name is (1R,2R,5S)-5-ethyl-2,6,6-trimethylbicyclo[3.1.1]heptane-1-thiol.
| Compound Name | (1R,2R,5S)-5-ethyl-2,6,6-trimethylbicyclo[3.1.1]heptane-1-thiol |
|---|---|
| PubChem CID | 155446054 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (1R,2R,5S)-5-ethyl-2,6,6-trimethylbicyclo[3.1.1]heptane-1-thiol |
| SMILES | CC[C@]12CC[C@@H](C)[C@](S)(C1)C2(C)C |
| InChI | InChI=1S/C12H22S/c1-5-11-7-6-9(2)12(13,8-11)10(11,3)4/h9,13H,5-8H2,1-4H3/t9-,11+,12-/m1/s1 |
| InChIKey | RUXBGMIERUBKNE-ADEWGFFLSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|