About N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide
N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide (PubChem CID 155447958) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide |
| PubChem CID | 155447958 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide |
| SMILES | C=C(N(/C=N/C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-10(11(2,3)4)14(9-13-8)12(5,6)7/h9H,1H2,2-8H3/b13-9+ |
| InChIKey | BBPLKUKVCMKEAC-UKTHLTGXSA-N |
| XLogP | 3.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide?
The IUPAC name of N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide (CID 155447958) is N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide.
What is the SMILES notation for N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide?
The canonical SMILES for N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide is C=C(N(/C=N/C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide?
The InChIKey is BBPLKUKVCMKEAC-UKTHLTGXSA-N. The full InChI is InChI=1S/C12H24N2/c1-10(11(2,3)4)14(9-13-8)12(5,6)7/h9H,1H2,2-8H3/b13-9+.
What are the key properties of N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide?
N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide has a molecular weight of 196.34 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N-(3,3-dimethylbut-1-en-2-yl)-N'-methylmethanimidamide is sourced from PubChem (CID 155447958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).