C14H24O6S — CID 155448270
2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)methoxy]ethanethiol (PubChem CID 155448270) has the molecular formula C14H24O6S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)methoxy]ethanethiol.
| Compound Name | 2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)methoxy]ethanethiol |
|---|---|
| PubChem CID | 155448270 |
| Molecular Formula | C14H24O6S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl)methoxy]ethanethiol |
| SMILES | CC1(C)OC2COC3(COCCS)OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C14H24O6S/c1-12(2)17-9-7-16-14(8-15-5-6-21)11(10(9)18-12)19-13(3,4)20-14/h9-11,21H,5-8H2,1-4H3 |
| InChIKey | NTXXLYRWZKTMQY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|