C28H29NO — CID 155448368
(2Z)-2-[3-(2,4,6-trimethylphenyl)spiro[benzo[e]indole-1,1'-cyclohexane]-2-ylidene]acetaldehyde (PubChem CID 155448368) has the molecular formula C28H29NO and a molecular weight of 395.55 g/mol. Its IUPAC name is (2Z)-2-[3-(2,4,6-trimethylphenyl)spiro[benzo[e]indole-1,1'-cyclohexane]-2-ylidene]acetaldehyde.
| Compound Name | (2Z)-2-[3-(2,4,6-trimethylphenyl)spiro[benzo[e]indole-1,1'-cyclohexane]-2-ylidene]acetaldehyde |
|---|---|
| PubChem CID | 155448368 |
| Molecular Formula | C28H29NO |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (2Z)-2-[3-(2,4,6-trimethylphenyl)spiro[benzo[e]indole-1,1'-cyclohexane]-2-ylidene]acetaldehyde |
| SMILES | Cc1cc(C)c(N2/C(=C\C=O)C3(CCCCC3)c3c2ccc2ccccc32)c(C)c1 |
| InChI | InChI=1S/C28H29NO/c1-19-17-20(2)27(21(3)18-19)29-24-12-11-22-9-5-6-10-23(22)26(24)28(25(29)13-16-30)14-7-4-8-15-28/h5-6,9-13,16-18H,4,7-8,14-15H2,1-3H3/b25-13- |
| InChIKey | VXVASDMXPGVKPJ-MXAYSNPKSA-N |
| XLogP | 7.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|