C33H31N3O2 — CID 155448615
6-[(2Z)-2-(3'-ethyl-9',9'-dimethylspiro[cyclohexane-1,1'-indeno[2,1-f]indole]-2'-ylidene)ethylidene]cyclopenta[b]pyrazine-5,7-dione (PubChem CID 155448615) has the molecular formula C33H31N3O2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 6-[(2Z)-2-(3'-ethyl-9',9'-dimethylspiro[cyclohexane-1,1'-indeno[2,1-f]indole]-2'-ylidene)ethylidene]cyclopenta[b]pyrazine-5,7-dione.
| Compound Name | 6-[(2Z)-2-(3'-ethyl-9',9'-dimethylspiro[cyclohexane-1,1'-indeno[2,1-f]indole]-2'-ylidene)ethylidene]cyclopenta[b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 155448615 |
| Molecular Formula | C33H31N3O2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 6-[(2Z)-2-(3'-ethyl-9',9'-dimethylspiro[cyclohexane-1,1'-indeno[2,1-f]indole]-2'-ylidene)ethylidene]cyclopenta[b]pyrazine-5,7-dione |
| SMILES | CCN1/C(=C\C=C2C(=O)c3nccnc3C2=O)C2(CCCCC2)c2cc3c(cc21)-c1ccccc1C3(C)C |
| InChI | InChI=1S/C33H31N3O2/c1-4-36-26-18-22-20-10-6-7-11-23(20)32(2,3)24(22)19-25(26)33(14-8-5-9-15-33)27(36)13-12-21-30(37)28-29(31(21)38)35-17-16-34-28/h6-7,10-13,16-19H,4-5,8-9,14-15H2,1-3H3/b27-13- |
| InChIKey | CWGYOCFZSOBRCG-WKIKZPBSSA-N |
| XLogP | 6.71 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|