C32H27N3O2 — CID 155448624
6-[(2E)-2-[1,1-dimethyl-3-(2,4,6-trimethylphenyl)benzo[e]indol-2-ylidene]ethylidene]cyclopenta[b]pyrazine-5,7-dione (PubChem CID 155448624) has the molecular formula C32H27N3O2 and a molecular weight of 485.59 g/mol. Its IUPAC name is 6-[(2E)-2-[1,1-dimethyl-3-(2,4,6-trimethylphenyl)benzo[e]indol-2-ylidene]ethylidene]cyclopenta[b]pyrazine-5,7-dione.
| Compound Name | 6-[(2E)-2-[1,1-dimethyl-3-(2,4,6-trimethylphenyl)benzo[e]indol-2-ylidene]ethylidene]cyclopenta[b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 155448624 |
| Molecular Formula | C32H27N3O2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 6-[(2E)-2-[1,1-dimethyl-3-(2,4,6-trimethylphenyl)benzo[e]indol-2-ylidene]ethylidene]cyclopenta[b]pyrazine-5,7-dione |
| SMILES | Cc1cc(C)c(N2/C(=C/C=C3C(=O)c4nccnc4C3=O)C(C)(C)c3c2ccc2ccccc32)c(C)c1 |
| InChI | InChI=1S/C32H27N3O2/c1-18-16-19(2)29(20(3)17-18)35-24-12-10-21-8-6-7-9-22(21)26(24)32(4,5)25(35)13-11-23-30(36)27-28(31(23)37)34-15-14-33-27/h6-17H,1-5H3/b25-13+ |
| InChIKey | AJZGEJZRRBZZQO-DHRITJCHSA-N |
| XLogP | 6.87 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|