About (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate
(1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate (PubChem CID 155449740) has the molecular formula C18H35NO2
and a molecular weight of 297.48 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate |
| PubChem CID | 155449740 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate |
| SMILES | CCC1(OC(=O)C(C)(CC(C)(C)C)C(C)(C)N)CCCC1 |
| InChI | InChI=1S/C18H35NO2/c1-8-18(11-9-10-12-18)21-14(20)17(7,16(5,6)19)13-15(2,3)4/h8-13,19H2,1-7H3 |
| InChIKey | SLDWBTGKAXHMFH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate?
The IUPAC name of (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate (CID 155449740) is (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate.
What is the SMILES notation for (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate?
The canonical SMILES for (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate is CCC1(OC(=O)C(C)(CC(C)(C)C)C(C)(C)N)CCCC1.
What is the InChIKey of (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate?
The InChIKey is SLDWBTGKAXHMFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO2/c1-8-18(11-9-10-12-18)21-14(20)17(7,16(5,6)19)13-15(2,3)4/h8-13,19H2,1-7H3.
What are the key properties of (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate?
(1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate has a molecular weight of 297.48 g/mol, XLogP of 4.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 2-(2-aminopropan-2-yl)-2,4,4-trimethylpentanoate is sourced from PubChem (CID 155449740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).